C17H18N2O2 — CID 156779855
benzyl 3-(1H-pyrazol-5-yl)cyclohex-2-ene-1-carboxylate (PubChem CID 156779855) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is benzyl 3-(1H-pyrazol-5-yl)cyclohex-2-ene-1-carboxylate.
| Compound Name | benzyl 3-(1H-pyrazol-5-yl)cyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 156779855 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | benzyl 3-(1H-pyrazol-5-yl)cyclohex-2-ene-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1C=C(c2ccn[nH]2)CCC1 |
| InChI | InChI=1S/C17H18N2O2/c20-17(21-12-13-5-2-1-3-6-13)15-8-4-7-14(11-15)16-9-10-18-19-16/h1-3,5-6,9-11,15H,4,7-8,12H2,(H,18,19) |
| InChIKey | FZCFQGMUYZHMEL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |