C15H10ClN3O — CID 156780107
4-(3-chlorophenyl)-6-phenyl-1H-1,3,5-triazin-2-one (PubChem CID 156780107) has the molecular formula C15H10ClN3O and a molecular weight of 283.72 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-6-phenyl-1H-1,3,5-triazin-2-one.
| Compound Name | 4-(3-chlorophenyl)-6-phenyl-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 156780107 |
| Molecular Formula | C15H10ClN3O |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4-(3-chlorophenyl)-6-phenyl-1H-1,3,5-triazin-2-one |
| SMILES | O=c1nc(-c2cccc(Cl)c2)nc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C15H10ClN3O/c16-12-8-4-7-11(9-12)14-17-13(18-15(20)19-14)10-5-2-1-3-6-10/h1-9H,(H,17,18,19,20) |
| InChIKey | ABQWNEFXYHOXNN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |