C41H78ClNO2 — CID 156780724
[(9Z,28Z)-18,20-dioxoheptatriaconta-9,28-dien-19-yl]-methyl-propan-2-ylazanium chloride (PubChem CID 156780724) has the molecular formula C41H78ClNO2 and a molecular weight of 652.53 g/mol. Its IUPAC name is [(9Z,28Z)-18,20-dioxoheptatriaconta-9,28-dien-19-yl]-methyl-propan-2-ylazanium chloride.
| Compound Name | [(9Z,28Z)-18,20-dioxoheptatriaconta-9,28-dien-19-yl]-methyl-propan-2-ylazanium chloride |
|---|---|
| PubChem CID | 156780724 |
| Molecular Formula | C41H78ClNO2 |
| Molecular Weight | 652.53 g/mol |
| Exact Mass | 651.57 |
| IUPAC Name | [(9Z,28Z)-18,20-dioxoheptatriaconta-9,28-dien-19-yl]-methyl-propan-2-ylazanium chloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(C(=O)CCCCCCC/C=C\CCCCCCCC)[NH+](C)C(C)C.[Cl-] |
| InChI | InChI=1S/C41H77NO2.ClH/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-39(43)41(42(5)38(3)4)40(44)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;/h20-23,38,41H,6-19,24-37H2,1-5H3;1H/b22-20-,23-21-; |
| InChIKey | JGSQTXXLBMZYEE-LQDDAWAPSA-N |
| XLogP | 8.50 |
| TPSA | 38.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.53 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|