C26H23N3O3 — CID 156783037
ethyl 2-(3-benzyl-5-phenylpyrazin-2-yl)imino-3-(furan-2-yl)propanoate (PubChem CID 156783037) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is ethyl 2-(3-benzyl-5-phenylpyrazin-2-yl)imino-3-(furan-2-yl)propanoate.
| Compound Name | ethyl 2-(3-benzyl-5-phenylpyrazin-2-yl)imino-3-(furan-2-yl)propanoate |
|---|---|
| PubChem CID | 156783037 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | ethyl 2-(3-benzyl-5-phenylpyrazin-2-yl)imino-3-(furan-2-yl)propanoate |
| SMILES | CCOC(=O)/C(Cc1ccco1)=N/c1ncc(-c2ccccc2)nc1Cc1ccccc1 |
| InChI | InChI=1S/C26H23N3O3/c1-2-31-26(30)23(17-21-14-9-15-32-21)29-25-22(16-19-10-5-3-6-11-19)28-24(18-27-25)20-12-7-4-8-13-20/h3-15,18H,2,16-17H2,1H3/b29-23+ |
| InChIKey | BTHNTPWVKWTWAH-BYNJWEBRSA-N |
| XLogP | 5.21 |
| TPSA | 77.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|