About 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane
1,3-dichloro-5-(trimethoxymethyl)benzene;ethane (PubChem CID 156791864) has the molecular formula C12H18Cl2O3
and a molecular weight of 281.18 g/mol. Its IUPAC name is 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane.
Molecular Properties
| Compound Name | 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane |
| PubChem CID | 156791864 |
| Molecular Formula | C12H18Cl2O3 |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane |
| SMILES | CC.COC(OC)(OC)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2O3.C2H6/c1-13-10(14-2,15-3)7-4-8(11)6-9(12)5-7;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | NBXAHMHCVHEZQS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane?
The IUPAC name of 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane (CID 156791864) is 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane.
What is the SMILES notation for 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane?
The canonical SMILES for 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane is CC.COC(OC)(OC)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane?
The InChIKey is NBXAHMHCVHEZQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2O3.C2H6/c1-13-10(14-2,15-3)7-4-8(11)6-9(12)5-7;1-2/h4-6H,1-3H3;1-2H3.
What are the key properties of 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane?
1,3-dichloro-5-(trimethoxymethyl)benzene;ethane has a molecular weight of 281.18 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane is sourced from PubChem (CID 156791864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).