C12H18Cl2O3 — CID 156791864
1,3-dichloro-5-(trimethoxymethyl)benzene;ethane (PubChem CID 156791864) has the molecular formula C12H18Cl2O3 and a molecular weight of 281.18 g/mol. Its IUPAC name is 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane.
| Compound Name | 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane |
|---|---|
| PubChem CID | 156791864 |
| Molecular Formula | C12H18Cl2O3 |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 1,3-dichloro-5-(trimethoxymethyl)benzene;ethane |
| SMILES | CC.COC(OC)(OC)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2O3.C2H6/c1-13-10(14-2,15-3)7-4-8(11)6-9(12)5-7;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | NBXAHMHCVHEZQS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|