C14H24N2 — CID 156796102
1'-methylspiro[1,2,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine-3,5'-cycloheptene] (PubChem CID 156796102) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 1'-methylspiro[1,2,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine-3,5'-cycloheptene].
| Compound Name | 1'-methylspiro[1,2,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine-3,5'-cycloheptene] |
|---|---|
| PubChem CID | 156796102 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1'-methylspiro[1,2,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridine-3,5'-cycloheptene] |
| SMILES | CC1=CCCC2(CC1)CNC1CCCNC12 |
| InChI | InChI=1S/C14H24N2/c1-11-4-2-7-14(8-6-11)10-16-12-5-3-9-15-13(12)14/h4,12-13,15-16H,2-3,5-10H2,1H3 |
| InChIKey | MKFCLLOGPXPIDT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|