C27H32F3NO2S — CID 156800894
1-[1-[4-[3-(2-ethylsulfanylethoxy)oxetan-3-yl]phenyl]ethenyl]-4-[4-(trifluoromethyl)phenyl]piperidine (PubChem CID 156800894) has the molecular formula C27H32F3NO2S and a molecular weight of 491.62 g/mol. Its IUPAC name is 1-[1-[4-[3-(2-ethylsulfanylethoxy)oxetan-3-yl]phenyl]ethenyl]-4-[4-(trifluoromethyl)phenyl]piperidine.
| Compound Name | 1-[1-[4-[3-(2-ethylsulfanylethoxy)oxetan-3-yl]phenyl]ethenyl]-4-[4-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 156800894 |
| Molecular Formula | C27H32F3NO2S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 1-[1-[4-[3-(2-ethylsulfanylethoxy)oxetan-3-yl]phenyl]ethenyl]-4-[4-(trifluoromethyl)phenyl]piperidine |
| SMILES | C=C(c1ccc(C2(OCCSCC)COC2)cc1)N1CCC(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C27H32F3NO2S/c1-3-34-17-16-33-26(18-32-19-26)24-8-4-21(5-9-24)20(2)31-14-12-23(13-15-31)22-6-10-25(11-7-22)27(28,29)30/h4-11,23H,2-3,12-19H2,1H3 |
| InChIKey | AMOMAVPBWBUVFD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|