C24H25F3N2O2 — CID 156560938
3-[4-[5-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboximidoyl]phenyl]oxetan-3-ol (PubChem CID 156560938) has the molecular formula C24H25F3N2O2 and a molecular weight of 430.47 g/mol. Its IUPAC name is 3-[4-[5-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboximidoyl]phenyl]oxetan-3-ol.
| Compound Name | 3-[4-[5-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboximidoyl]phenyl]oxetan-3-ol |
|---|---|
| PubChem CID | 156560938 |
| Molecular Formula | C24H25F3N2O2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 3-[4-[5-[4-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboximidoyl]phenyl]oxetan-3-ol |
| SMILES | [H]/N=C(/c1ccc(C2(O)COC2)cc1)N1CC2CC(c3ccc(C(F)(F)F)cc3)CC2C1 |
| InChI | InChI=1S/C24H25F3N2O2/c25-24(26,27)21-7-1-15(2-8-21)17-9-18-11-29(12-19(18)10-17)22(28)16-3-5-20(6-4-16)23(30)13-31-14-23/h1-8,17-19,28,30H,9-14H2/b28-22- |
| InChIKey | QAVNLPTXLPWRMH-SLMZUGIISA-N |
| XLogP | 4.37 |
| TPSA | 56.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|