C9H19NO3 — CID 156802298
(5-methylideneoxolan-2-yl)methanamine;propane-2,2-diol (PubChem CID 156802298) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is (5-methylideneoxolan-2-yl)methanamine;propane-2,2-diol.
| Compound Name | (5-methylideneoxolan-2-yl)methanamine;propane-2,2-diol |
|---|---|
| PubChem CID | 156802298 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | (5-methylideneoxolan-2-yl)methanamine;propane-2,2-diol |
| SMILES | C=C1CCC(CN)O1.CC(C)(O)O |
| InChI | InChI=1S/C6H11NO.C3H8O2/c1-5-2-3-6(4-7)8-5;1-3(2,4)5/h6H,1-4,7H2;4-5H,1-2H3 |
| InChIKey | AWIRCZXBVSYEDM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|