C16H15F3N4S — CID 156805531
2-[methylsulfanyl-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methylidene]propanedinitrile (PubChem CID 156805531) has the molecular formula C16H15F3N4S and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[methylsulfanyl-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methylidene]propanedinitrile.
| Compound Name | 2-[methylsulfanyl-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 156805531 |
| Molecular Formula | C16H15F3N4S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-[methylsulfanyl-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methylidene]propanedinitrile |
| SMILES | CSC(=C(C#N)C#N)N1CCN(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H15F3N4S/c1-24-15(12(10-20)11-21)23-8-6-22(7-9-23)14-4-2-13(3-5-14)16(17,18)19/h2-5H,6-9H2,1H3 |
| InChIKey | BZWYXPOAGXIAEM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|