C20H24F3N5S — CID 91287317
2-cyano-N-(dimethylaminomethylidene)-3-[4-[4-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]but-2-enethioamide (PubChem CID 91287317) has the molecular formula C20H24F3N5S and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-cyano-N-(dimethylaminomethylidene)-3-[4-[4-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]but-2-enethioamide.
| Compound Name | 2-cyano-N-(dimethylaminomethylidene)-3-[4-[4-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]but-2-enethioamide |
|---|---|
| PubChem CID | 91287317 |
| Molecular Formula | C20H24F3N5S |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-cyano-N-(dimethylaminomethylidene)-3-[4-[4-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]but-2-enethioamide |
| SMILES | CC(=C(C#N)C(=S)/N=C/N(C)C)N1CCCN(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H24F3N5S/c1-15(18(13-24)19(29)25-14-26(2)3)27-9-4-10-28(12-11-27)17-7-5-16(6-8-17)20(21,22)23/h5-8,14H,4,9-12H2,1-3H3/b18-15?,25-14+ |
| InChIKey | FWRDUFHDDLQZGG-QRPPAVTRSA-N |
| XLogP | 3.93 |
| TPSA | 45.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|