C19H25N5OS — CID 87802818
2-[4-[4-[(Z)-4-amino-3-cyano-4-sulfanylidenebut-2-en-2-yl]piperazin-1-yl]phenyl]-N,N-dimethylacetamide (PubChem CID 87802818) has the molecular formula C19H25N5OS and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-[4-[4-[(Z)-4-amino-3-cyano-4-sulfanylidenebut-2-en-2-yl]piperazin-1-yl]phenyl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[4-[(Z)-4-amino-3-cyano-4-sulfanylidenebut-2-en-2-yl]piperazin-1-yl]phenyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 87802818 |
| Molecular Formula | C19H25N5OS |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-[4-[4-[(Z)-4-amino-3-cyano-4-sulfanylidenebut-2-en-2-yl]piperazin-1-yl]phenyl]-N,N-dimethylacetamide |
| SMILES | C/C(=C(\C#N)C(N)=S)N1CCN(c2ccc(CC(=O)N(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H25N5OS/c1-14(17(13-20)19(21)26)23-8-10-24(11-9-23)16-6-4-15(5-7-16)12-18(25)22(2)3/h4-7H,8-12H2,1-3H3,(H2,21,26)/b17-14- |
| InChIKey | LOHNKCHUFYWHOY-VKAVYKQESA-N |
| XLogP | 1.52 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|