C20H19F6N7O2 — CID 156808499
2,6-diamino-5-[3-(2,2,2-trifluoroethyl)-1,2,4-triazol-1-yl]-N-[[4-[(2R)-1,1,1-trifluoropropan-2-yl]oxyphenyl]methyl]pyridine-3-carboxamide (PubChem CID 156808499) has the molecular formula C20H19F6N7O2 and a molecular weight of 503.41 g/mol. Its IUPAC name is 2,6-diamino-5-[3-(2,2,2-trifluoroethyl)-1,2,4-triazol-1-yl]-N-[[4-[(2R)-1,1,1-trifluoropropan-2-yl]oxyphenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 2,6-diamino-5-[3-(2,2,2-trifluoroethyl)-1,2,4-triazol-1-yl]-N-[[4-[(2R)-1,1,1-trifluoropropan-2-yl]oxyphenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156808499 |
| Molecular Formula | C20H19F6N7O2 |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 2,6-diamino-5-[3-(2,2,2-trifluoroethyl)-1,2,4-triazol-1-yl]-N-[[4-[(2R)-1,1,1-trifluoropropan-2-yl]oxyphenyl]methyl]pyridine-3-carboxamide |
| SMILES | C[C@@H](Oc1ccc(CNC(=O)c2cc(-n3cnc(CC(F)(F)F)n3)c(N)nc2N)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H19F6N7O2/c1-10(20(24,25)26)35-12-4-2-11(3-5-12)8-29-18(34)13-6-14(17(28)31-16(13)27)33-9-30-15(32-33)7-19(21,22)23/h2-6,9-10H,7-8H2,1H3,(H,29,34)(H4,27,28,31)/t10-/m1/s1 |
| InChIKey | LELLQFJDJPDENL-SNVBAGLBSA-N |
| XLogP | 3.19 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |