C16H16F3IN4O2 — CID 175280854
2,6-diamino-5-iodo-N-[[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]methyl]pyridine-3-carboxamide (PubChem CID 175280854) has the molecular formula C16H16F3IN4O2 and a molecular weight of 480.23 g/mol. Its IUPAC name is 2,6-diamino-5-iodo-N-[[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 2,6-diamino-5-iodo-N-[[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175280854 |
| Molecular Formula | C16H16F3IN4O2 |
| Molecular Weight | 480.23 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 2,6-diamino-5-iodo-N-[[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]methyl]pyridine-3-carboxamide |
| SMILES | CC(Oc1ccc(CNC(=O)c2cc(I)c(N)nc2N)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H16F3IN4O2/c1-8(16(17,18)19)26-10-4-2-9(3-5-10)7-23-15(25)11-6-12(20)14(22)24-13(11)21/h2-6,8H,7H2,1H3,(H,23,25)(H4,21,22,24) |
| InChIKey | ZNTVVLISOVYOEC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|