C29H24N2O3 — CID 156812504
[4-[(13-hydroxy-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-yl)oxy]phenyl]-(4-methylphenyl)methanone (PubChem CID 156812504) has the molecular formula C29H24N2O3 and a molecular weight of 448.52 g/mol. Its IUPAC name is [4-[(13-hydroxy-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-yl)oxy]phenyl]-(4-methylphenyl)methanone.
| Compound Name | [4-[(13-hydroxy-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-yl)oxy]phenyl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 156812504 |
| Molecular Formula | C29H24N2O3 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | [4-[(13-hydroxy-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-yl)oxy]phenyl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2ccc(Oc3ccc4c(c3)CN3CN4Cc4cc(O)ccc43)cc2)cc1 |
| InChI | InChI=1S/C29H24N2O3/c1-19-2-4-20(5-3-19)29(33)21-6-9-25(10-7-21)34-26-11-13-28-23(15-26)17-31-18-30(28)16-22-14-24(32)8-12-27(22)31/h2-15,32H,16-18H2,1H3 |
| InChIKey | RHVRSIJUNLTVTQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |