C15H18O4 — CID 156812708
(3-spiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-ylphenyl)methanol (PubChem CID 156812708) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (3-spiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-ylphenyl)methanol.
| Compound Name | (3-spiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-ylphenyl)methanol |
|---|---|
| PubChem CID | 156812708 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (3-spiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-ylphenyl)methanol |
| SMILES | OCc1cccc(C23CCC4(CC2O3)OCCO4)c1 |
| InChI | InChI=1S/C15H18O4/c16-10-11-2-1-3-12(8-11)15-5-4-14(9-13(15)19-15)17-6-7-18-14/h1-3,8,13,16H,4-7,9-10H2 |
| InChIKey | RNCGNGZMTYEIMO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|