C30H34O6 — CID 170189125
propyl (3S)-3-[4-[(3-spiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-ylphenyl)methoxy]phenyl]hex-4-ynoate (PubChem CID 170189125) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is propyl (3S)-3-[4-[(3-spiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-ylphenyl)methoxy]phenyl]hex-4-ynoate.
| Compound Name | propyl (3S)-3-[4-[(3-spiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-ylphenyl)methoxy]phenyl]hex-4-ynoate |
|---|---|
| PubChem CID | 170189125 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | propyl (3S)-3-[4-[(3-spiro[1,3-dioxolane-2,4'-7-oxabicyclo[4.1.0]heptane]-1'-ylphenyl)methoxy]phenyl]hex-4-ynoate |
| SMILES | CC#C[C@@H](CC(=O)OCCC)c1ccc(OCc2cccc(C34CCC5(CC3O4)OCCO5)c2)cc1 |
| InChI | InChI=1S/C30H34O6/c1-3-6-24(19-28(31)32-15-4-2)23-9-11-26(12-10-23)33-21-22-7-5-8-25(18-22)30-14-13-29(20-27(30)36-30)34-16-17-35-29/h5,7-12,18,24,27H,4,13-17,19-21H2,1-2H3/t24-,27?,30?/m0/s1 |
| InChIKey | PUSVYXCTPLZAIN-LMRVFMMHSA-N |
| XLogP | 5.24 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|