About methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+)
methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+) (PubChem CID 156813265) has the molecular formula C14H12N3O6Rb
and a molecular weight of 403.73 g/mol. Its IUPAC name is methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+).
Molecular Properties
| Compound Name | methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+) |
| PubChem CID | 156813265 |
| Molecular Formula | C14H12N3O6Rb |
| Molecular Weight | 403.73 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+) |
| SMILES | COC(=O)c1c[c-]c(Cn2ncc([N+](=O)[O-])c2C(=O)OC)cc1.[Rb+] |
| InChI | InChI=1S/C14H12N3O6.Rb/c1-22-13(18)10-5-3-9(4-6-10)8-16-12(14(19)23-2)11(7-15-16)17(20)21;/h3,5-7H,8H2,1-2H3;/q-1;+1 |
| InChIKey | JNAVUYRIGSHCMR-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 113.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.73 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+)?
The IUPAC name of methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+) (CID 156813265) is methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+).
What is the SMILES notation for methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+)?
The canonical SMILES for methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+) is COC(=O)c1c[c-]c(Cn2ncc([N+](=O)[O-])c2C(=O)OC)cc1.[Rb+].
What is the InChIKey of methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+)?
The InChIKey is JNAVUYRIGSHCMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N3O6.Rb/c1-22-13(18)10-5-3-9(4-6-10)8-16-12(14(19)23-2)11(7-15-16)17(20)21;/h3,5-7H,8H2,1-2H3;/q-1;+1.
What are the key properties of methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+)?
methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+) has a molecular weight of 403.73 g/mol, XLogP of -1.78, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(4-methoxycarbonylbenzene-6-id-1-yl)methyl]-4-nitropyrazole-5-carboxylate;rubidium(1+) is sourced from PubChem (CID 156813265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).