C23H23F3N2O2 — CID 156815461
[(2S)-1-(4-phenylphenyl)pyrrolidin-2-yl]methanol;5-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 156815461) has the molecular formula C23H23F3N2O2 and a molecular weight of 416.44 g/mol. Its IUPAC name is [(2S)-1-(4-phenylphenyl)pyrrolidin-2-yl]methanol;5-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | [(2S)-1-(4-phenylphenyl)pyrrolidin-2-yl]methanol;5-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 156815461 |
| Molecular Formula | C23H23F3N2O2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [(2S)-1-(4-phenylphenyl)pyrrolidin-2-yl]methanol;5-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1ccc(C(F)(F)F)c[nH]1.OC[C@@H]1CCCN1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19NO.C6H4F3NO/c19-13-17-7-4-12-18(17)16-10-8-15(9-11-16)14-5-2-1-3-6-14;7-6(8,9)4-1-2-5(11)10-3-4/h1-3,5-6,8-11,17,19H,4,7,12-13H2;1-3H,(H,10,11)/t17-;/m0./s1 |
| InChIKey | QWDXBXGXJMBBGE-LMOVPXPDSA-N |
| XLogP | 4.71 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |