C15H21ClN4O2 — CID 156818032
[6-(1-methoxycarbonylpiperidin-3-yl)-1H-benzimidazol-2-yl]methylazanium chloride (PubChem CID 156818032) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is [6-(1-methoxycarbonylpiperidin-3-yl)-1H-benzimidazol-2-yl]methylazanium chloride.
| Compound Name | [6-(1-methoxycarbonylpiperidin-3-yl)-1H-benzimidazol-2-yl]methylazanium chloride |
|---|---|
| PubChem CID | 156818032 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | [6-(1-methoxycarbonylpiperidin-3-yl)-1H-benzimidazol-2-yl]methylazanium chloride |
| SMILES | COC(=O)N1CCCC(c2ccc3nc(C[NH3+])[nH]c3c2)C1.[Cl-] |
| InChI | InChI=1S/C15H20N4O2.ClH/c1-21-15(20)19-6-2-3-11(9-19)10-4-5-12-13(7-10)18-14(8-16)17-12;/h4-5,7,11H,2-3,6,8-9,16H2,1H3,(H,17,18);1H |
| InChIKey | ABDAPFJMAPIPER-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |