C23H23N5O2 — CID 156828014
4-benzyl-N-(1H-pyrrolo[2,3-b]pyridin-6-yl)-2,3-dihydro-1,4-benzoxazin-6-amine;formamide (PubChem CID 156828014) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-benzyl-N-(1H-pyrrolo[2,3-b]pyridin-6-yl)-2,3-dihydro-1,4-benzoxazin-6-amine;formamide.
| Compound Name | 4-benzyl-N-(1H-pyrrolo[2,3-b]pyridin-6-yl)-2,3-dihydro-1,4-benzoxazin-6-amine;formamide |
|---|---|
| PubChem CID | 156828014 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 4-benzyl-N-(1H-pyrrolo[2,3-b]pyridin-6-yl)-2,3-dihydro-1,4-benzoxazin-6-amine;formamide |
| SMILES | NC=O.c1ccc(CN2CCOc3ccc(Nc4ccc5cc[nH]c5n4)cc32)cc1 |
| InChI | InChI=1S/C22H20N4O.CH3NO/c1-2-4-16(5-3-1)15-26-12-13-27-20-8-7-18(14-19(20)26)24-21-9-6-17-10-11-23-22(17)25-21;2-1-3/h1-11,14H,12-13,15H2,(H2,23,24,25);1H,(H2,2,3) |
| InChIKey | TVZGPLCUXQQGFR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|