C14H10F3NO6 — CID 156828467
acetyloxymethyl 2-[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]acetate (PubChem CID 156828467) has the molecular formula C14H10F3NO6 and a molecular weight of 345.23 g/mol. Its IUPAC name is acetyloxymethyl 2-[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]acetate.
| Compound Name | acetyloxymethyl 2-[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 156828467 |
| Molecular Formula | C14H10F3NO6 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | acetyloxymethyl 2-[2,3-dioxo-5-(trifluoromethyl)indol-1-yl]acetate |
| SMILES | CC(=O)OCOC(=O)CN1C(=O)C(=O)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H10F3NO6/c1-7(19)23-6-24-11(20)5-18-10-3-2-8(14(15,16)17)4-9(10)12(21)13(18)22/h2-4H,5-6H2,1H3 |
| InChIKey | OGXPICAUPZITAL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|