C13H12NNaO7S — CID 129218513
sodium 2,3-dioxo-1-(2-oxo-2-propan-2-yloxyethyl)indole-5-sulfonate (PubChem CID 129218513) has the molecular formula C13H12NNaO7S and a molecular weight of 349.30 g/mol. Its IUPAC name is sodium 2,3-dioxo-1-(2-oxo-2-propan-2-yloxyethyl)indole-5-sulfonate.
| Compound Name | sodium 2,3-dioxo-1-(2-oxo-2-propan-2-yloxyethyl)indole-5-sulfonate |
|---|---|
| PubChem CID | 129218513 |
| Molecular Formula | C13H12NNaO7S |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | sodium 2,3-dioxo-1-(2-oxo-2-propan-2-yloxyethyl)indole-5-sulfonate |
| SMILES | CC(C)OC(=O)CN1C(=O)C(=O)c2cc(S(=O)(=O)[O-])ccc21.[Na+] |
| InChI | InChI=1S/C13H13NO7S.Na/c1-7(2)21-11(15)6-14-10-4-3-8(22(18,19)20)5-9(10)12(16)13(14)17;/h3-5,7H,6H2,1-2H3,(H,18,19,20);/q;+1/p-1 |
| InChIKey | HLLBDZHUSCRCLV-UHFFFAOYSA-M |
| XLogP | -2.92 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|