C9H13IN- — CID 156828548
N,4-dimethyl-N-methyliodanuidylaniline (PubChem CID 156828548) has the molecular formula C9H13IN- and a molecular weight of 262.11 g/mol. Its IUPAC name is N,4-dimethyl-N-methyliodanuidylaniline.
| Compound Name | N,4-dimethyl-N-methyliodanuidylaniline |
|---|---|
| PubChem CID | 156828548 |
| Molecular Formula | C9H13IN- |
| Molecular Weight | 262.11 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | N,4-dimethyl-N-methyliodanuidylaniline |
| SMILES | C[I-]N(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C9H13IN/c1-8-4-6-9(7-5-8)11(3)10-2/h4-7H,1-3H3/q-1 |
| InChIKey | NBKUOZLSKGKXIZ-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.11 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|