C28H39BN2O7 — CID 156828897
tert-butyl N-[2-[4-methoxy-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-6-carbonyl]-2-azabicyclo[2.2.1]heptan-7-yl]carbamate (PubChem CID 156828897) has the molecular formula C28H39BN2O7 and a molecular weight of 526.44 g/mol. Its IUPAC name is tert-butyl N-[2-[4-methoxy-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-6-carbonyl]-2-azabicyclo[2.2.1]heptan-7-yl]carbamate.
| Compound Name | tert-butyl N-[2-[4-methoxy-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-6-carbonyl]-2-azabicyclo[2.2.1]heptan-7-yl]carbamate |
|---|---|
| PubChem CID | 156828897 |
| Molecular Formula | C28H39BN2O7 |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | tert-butyl N-[2-[4-methoxy-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-6-carbonyl]-2-azabicyclo[2.2.1]heptan-7-yl]carbamate |
| SMILES | COc1cc(C(=O)N2CC3CCC2C3NC(=O)OC(C)(C)C)cc2oc(B3OC(C)(C)C(C)(C)O3)c(C)c12 |
| InChI | InChI=1S/C28H39BN2O7/c1-15-21-19(34-9)12-17(13-20(21)35-23(15)29-37-27(5,6)28(7,8)38-29)24(32)31-14-16-10-11-18(31)22(16)30-25(33)36-26(2,3)4/h12-13,16,18,22H,10-11,14H2,1-9H3,(H,30,33) |
| InChIKey | DJNHBHVZFHXCRQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|