C33H35N7O — CID 156833855
1-[6-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2,3-dihydroindol-1-yl]prop-2-en-1-one (PubChem CID 156833855) has the molecular formula C33H35N7O and a molecular weight of 545.69 g/mol. Its IUPAC name is 1-[6-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2,3-dihydroindol-1-yl]prop-2-en-1-one.
| Compound Name | 1-[6-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2,3-dihydroindol-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156833855 |
| Molecular Formula | C33H35N7O |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | 1-[6-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2,3-dihydroindol-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2ccc(-c3c(-c4ccc(N5CCN(C)CC5)cc4)[nH]c4ncc(C(=C/N)/C=N/C)cc34)cc21 |
| InChI | InChI=1S/C33H35N7O/c1-4-30(41)40-12-11-22-5-6-24(18-29(22)40)31-28-17-25(26(19-34)20-35-2)21-36-33(28)37-32(31)23-7-9-27(10-8-23)39-15-13-38(3)14-16-39/h4-10,17-21H,1,11-16,34H2,2-3H3,(H,36,37)/b26-19+,35-20+ |
| InChIKey | UZMQZAQLTBKSTO-NODMUBTPSA-N |
| XLogP | 4.72 |
| TPSA | 93.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|