C7H9N3O — CID 156846222
methane;5-methyloxadiazolo[5,4-b]pyridine (PubChem CID 156846222) has the molecular formula C7H9N3O and a molecular weight of 151.17 g/mol. Its IUPAC name is methane;5-methyloxadiazolo[5,4-b]pyridine.
| Compound Name | methane;5-methyloxadiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 156846222 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | methane;5-methyloxadiazolo[5,4-b]pyridine |
| SMILES | C.Cc1ccc2nnoc2n1 |
| InChI | InChI=1S/C6H5N3O.CH4/c1-4-2-3-5-6(7-4)10-9-8-5;/h2-3H,1H3;1H4 |
| InChIKey | GWOGPFDYQUIODR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |