About N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine
N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine (PubChem CID 156850160) has the molecular formula C14H32N2
and a molecular weight of 228.42 g/mol. Its IUPAC name is N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine.
Molecular Properties
| Compound Name | N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine |
| PubChem CID | 156850160 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine |
| SMILES | CC(C)NCC(CCCCN(C)C)C(C)C |
| InChI | InChI=1S/C14H32N2/c1-12(2)14(11-15-13(3)4)9-7-8-10-16(5)6/h12-15H,7-11H2,1-6H3 |
| InChIKey | GKTLOSPNASOVIF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine?
The IUPAC name of N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine (CID 156850160) is N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine.
What is the SMILES notation for N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine?
The canonical SMILES for N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine is CC(C)NCC(CCCCN(C)C)C(C)C.
What is the InChIKey of N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine?
The InChIKey is GKTLOSPNASOVIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32N2/c1-12(2)14(11-15-13(3)4)9-7-8-10-16(5)6/h12-15H,7-11H2,1-6H3.
What are the key properties of N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine?
N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine has a molecular weight of 228.42 g/mol, XLogP of 2.99, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dimethyl-N,2-di(propan-2-yl)hexane-1,6-diamine is sourced from PubChem (CID 156850160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).