C18H16N2O — CID 156855302
2-([1]benzofuro[2,3-b]pyrrol-3-yl)-4,6-dimethylaniline (PubChem CID 156855302) has the molecular formula C18H16N2O and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-([1]benzofuro[2,3-b]pyrrol-3-yl)-4,6-dimethylaniline.
| Compound Name | 2-([1]benzofuro[2,3-b]pyrrol-3-yl)-4,6-dimethylaniline |
|---|---|
| PubChem CID | 156855302 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-([1]benzofuro[2,3-b]pyrrol-3-yl)-4,6-dimethylaniline |
| SMILES | Cc1cc(C)c(N)c(-n2ccc3c4ccccc4oc32)c1 |
| InChI | InChI=1S/C18H16N2O/c1-11-9-12(2)17(19)15(10-11)20-8-7-14-13-5-3-4-6-16(13)21-18(14)20/h3-10H,19H2,1-2H3 |
| InChIKey | OQUVVNDKWVWFHB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 44.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|