C25H31NO5 — CID 156856937
7-(3,5-diethoxyphenyl)-N-[(4-hydroxy-3-methoxyphenyl)methyl]hept-6-ynamide (PubChem CID 156856937) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is 7-(3,5-diethoxyphenyl)-N-[(4-hydroxy-3-methoxyphenyl)methyl]hept-6-ynamide.
| Compound Name | 7-(3,5-diethoxyphenyl)-N-[(4-hydroxy-3-methoxyphenyl)methyl]hept-6-ynamide |
|---|---|
| PubChem CID | 156856937 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 7-(3,5-diethoxyphenyl)-N-[(4-hydroxy-3-methoxyphenyl)methyl]hept-6-ynamide |
| SMILES | CCOc1cc(C#CCCCCC(=O)NCc2ccc(O)c(OC)c2)cc(OCC)c1 |
| InChI | InChI=1S/C25H31NO5/c1-4-30-21-14-19(15-22(17-21)31-5-2)10-8-6-7-9-11-25(28)26-18-20-12-13-23(27)24(16-20)29-3/h12-17,27H,4-7,9,11,18H2,1-3H3,(H,26,28) |
| InChIKey | KDLRBBAMCNCGRY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|