C19H28O2 — CID 156857151
16-hydroxy-5,13-dimethyl-1,2,4,6,7,9,10,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 156857151) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 16-hydroxy-5,13-dimethyl-1,2,4,6,7,9,10,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 16-hydroxy-5,13-dimethyl-1,2,4,6,7,9,10,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 156857151 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 16-hydroxy-5,13-dimethyl-1,2,4,6,7,9,10,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC3C(=C1CC(O)C2)CCC1(C)CC(=O)CCC31 |
| InChI | InChI=1S/C19H28O2/c1-18-7-6-15-14(16(18)4-3-12(20)10-18)5-8-19(2)11-13(21)9-17(15)19/h13-14,16,21H,3-11H2,1-2H3 |
| InChIKey | YLSDDRCTKFCFOH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|