C13H11ClN4O — CID 156874871
(7-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)hydrazine (PubChem CID 156874871) has the molecular formula C13H11ClN4O and a molecular weight of 274.71 g/mol. Its IUPAC name is (7-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)hydrazine.
| Compound Name | (7-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)hydrazine |
|---|---|
| PubChem CID | 156874871 |
| Molecular Formula | C13H11ClN4O |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (7-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)hydrazine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NN)c2n1 |
| InChI | InChI=1S/C13H11ClN4O/c1-19-11-5-4-9-13(17-11)12(18-15)8-3-2-7(14)6-10(8)16-9/h2-6H,15H2,1H3,(H,16,18) |
| InChIKey | SECRTTHLULFPPF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|