C19H23ClN4O — CID 23337806
N-(8-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)-N',N'-dimethylbutane-1,4-diamine (PubChem CID 23337806) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is N-(8-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | N-(8-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 23337806 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-(8-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)-N',N'-dimethylbutane-1,4-diamine |
| SMILES | COc1ccc2nc3ccc(Cl)cc3c(NCCCCN(C)C)c2n1 |
| InChI | InChI=1S/C19H23ClN4O/c1-24(2)11-5-4-10-21-18-14-12-13(20)6-7-15(14)22-16-8-9-17(25-3)23-19(16)18/h6-9,12H,4-5,10-11H2,1-3H3,(H,21,22) |
| InChIKey | ZCVRTTAICIATDC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|