C19H23ClN4O — CID 70595117
1-N-(8-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)-1-N',1-N'-dimethylbutane-1,1-diamine (PubChem CID 70595117) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is 1-N-(8-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)-1-N',1-N'-dimethylbutane-1,1-diamine.
| Compound Name | 1-N-(8-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)-1-N',1-N'-dimethylbutane-1,1-diamine |
|---|---|
| PubChem CID | 70595117 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-N-(8-chloro-2-methoxybenzo[b][1,5]naphthyridin-10-yl)-1-N',1-N'-dimethylbutane-1,1-diamine |
| SMILES | CCCC(Nc1c2cc(Cl)ccc2nc2ccc(OC)nc12)N(C)C |
| InChI | InChI=1S/C19H23ClN4O/c1-5-6-16(24(2)3)22-18-13-11-12(20)7-8-14(13)21-15-9-10-17(25-4)23-19(15)18/h7-11,16H,5-6H2,1-4H3,(H,21,22) |
| InChIKey | AOBNQDCGASTSSX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|