C32H49N5O6 — CID 156882974
tert-butyl N-(4-aminocyclohexyl)-N-[8-oxo-8-[[1-oxo-2-(5-oxopentanoylamino)-3H-isoindol-4-yl]amino]octyl]carbamate (PubChem CID 156882974) has the molecular formula C32H49N5O6 and a molecular weight of 599.77 g/mol. Its IUPAC name is tert-butyl N-(4-aminocyclohexyl)-N-[8-oxo-8-[[1-oxo-2-(5-oxopentanoylamino)-3H-isoindol-4-yl]amino]octyl]carbamate.
| Compound Name | tert-butyl N-(4-aminocyclohexyl)-N-[8-oxo-8-[[1-oxo-2-(5-oxopentanoylamino)-3H-isoindol-4-yl]amino]octyl]carbamate |
|---|---|
| PubChem CID | 156882974 |
| Molecular Formula | C32H49N5O6 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.37 |
| IUPAC Name | tert-butyl N-(4-aminocyclohexyl)-N-[8-oxo-8-[[1-oxo-2-(5-oxopentanoylamino)-3H-isoindol-4-yl]amino]octyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCCCCC(=O)Nc1cccc2c1CN(NC(=O)CCCC=O)C2=O)C1CCC(N)CC1 |
| InChI | InChI=1S/C32H49N5O6/c1-32(2,3)43-31(42)36(24-18-16-23(33)17-19-24)20-9-6-4-5-7-14-28(39)34-27-13-11-12-25-26(27)22-37(30(25)41)35-29(40)15-8-10-21-38/h11-13,21,23-24H,4-10,14-20,22,33H2,1-3H3,(H,34,39)(H,35,40) |
| InChIKey | FIHPRAMXCLAZDC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|