C24H28N2O — CID 156886782
1-(4-butyl-3-phenyl-1H-pyrazol-5-yl)-4-(4-methylphenyl)butan-2-one (PubChem CID 156886782) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-(4-butyl-3-phenyl-1H-pyrazol-5-yl)-4-(4-methylphenyl)butan-2-one.
| Compound Name | 1-(4-butyl-3-phenyl-1H-pyrazol-5-yl)-4-(4-methylphenyl)butan-2-one |
|---|---|
| PubChem CID | 156886782 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-(4-butyl-3-phenyl-1H-pyrazol-5-yl)-4-(4-methylphenyl)butan-2-one |
| SMILES | CCCCc1c(-c2ccccc2)n[nH]c1CC(=O)CCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H28N2O/c1-3-4-10-22-23(25-26-24(22)20-8-6-5-7-9-20)17-21(27)16-15-19-13-11-18(2)12-14-19/h5-9,11-14H,3-4,10,15-17H2,1-2H3,(H,25,26) |
| InChIKey | YWDPKVUQZYCXNV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |