C13H15N5O3S — CID 156889816
3-(7-ethyl-2-methylsulfonyl-8-oxopurin-9-yl)cyclobutane-1-carbonitrile (PubChem CID 156889816) has the molecular formula C13H15N5O3S and a molecular weight of 321.36 g/mol. Its IUPAC name is 3-(7-ethyl-2-methylsulfonyl-8-oxopurin-9-yl)cyclobutane-1-carbonitrile.
| Compound Name | 3-(7-ethyl-2-methylsulfonyl-8-oxopurin-9-yl)cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 156889816 |
| Molecular Formula | C13H15N5O3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 3-(7-ethyl-2-methylsulfonyl-8-oxopurin-9-yl)cyclobutane-1-carbonitrile |
| SMILES | CCn1c(=O)n(C2CC(C#N)C2)c2nc(S(C)(=O)=O)ncc21 |
| InChI | InChI=1S/C13H15N5O3S/c1-3-17-10-7-15-12(22(2,20)21)16-11(10)18(13(17)19)9-4-8(5-9)6-14/h7-9H,3-5H2,1-2H3 |
| InChIKey | DOYIQGWGTCKTPJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 110.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |