C31H40N6O3 — CID 156892786
(Z,3E)-2-(4-tert-butyl-N-methylanilino)-3-[(methylideneamino)methylidene]-N-(pyridin-3-ylmethyl)hex-4-enamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile (PubChem CID 156892786) has the molecular formula C31H40N6O3 and a molecular weight of 544.70 g/mol. Its IUPAC name is (Z,3E)-2-(4-tert-butyl-N-methylanilino)-3-[(methylideneamino)methylidene]-N-(pyridin-3-ylmethyl)hex-4-enamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile.
| Compound Name | (Z,3E)-2-(4-tert-butyl-N-methylanilino)-3-[(methylideneamino)methylidene]-N-(pyridin-3-ylmethyl)hex-4-enamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 156892786 |
| Molecular Formula | C31H40N6O3 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | (Z,3E)-2-(4-tert-butyl-N-methylanilino)-3-[(methylideneamino)methylidene]-N-(pyridin-3-ylmethyl)hex-4-enamide;2-formyl-4-hydroxypyrrolidine-1-carbonitrile |
| SMILES | C=N/C=C(\C=C/C)C(C(=O)NCc1cccnc1)N(C)c1ccc(C(C)(C)C)cc1.N#CN1CC(O)CC1C=O |
| InChI | InChI=1S/C25H32N4O.C6H8N2O2/c1-7-9-20(18-26-5)23(24(30)28-17-19-10-8-15-27-16-19)29(6)22-13-11-21(12-14-22)25(2,3)4;7-4-8-2-6(10)1-5(8)3-9/h7-16,18,23H,5,17H2,1-4,6H3,(H,28,30);3,5-6,10H,1-2H2/b9-7-,20-18+; |
| InChIKey | XZUJZBFNWURFRT-VAHZUEKESA-N |
| XLogP | 3.76 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|