C29H41N5O2 — CID 156893205
(Z,3E)-2-(4-tert-butyl-N-methylanilino)-3-[(methylideneamino)methylidene]-1-pyrrolidin-1-ylhex-4-en-1-one;(2R)-2-formylpyrrolidine-1-carbonitrile (PubChem CID 156893205) has the molecular formula C29H41N5O2 and a molecular weight of 491.68 g/mol. Its IUPAC name is (Z,3E)-2-(4-tert-butyl-N-methylanilino)-3-[(methylideneamino)methylidene]-1-pyrrolidin-1-ylhex-4-en-1-one;(2R)-2-formylpyrrolidine-1-carbonitrile.
| Compound Name | (Z,3E)-2-(4-tert-butyl-N-methylanilino)-3-[(methylideneamino)methylidene]-1-pyrrolidin-1-ylhex-4-en-1-one;(2R)-2-formylpyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 156893205 |
| Molecular Formula | C29H41N5O2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.33 |
| IUPAC Name | (Z,3E)-2-(4-tert-butyl-N-methylanilino)-3-[(methylideneamino)methylidene]-1-pyrrolidin-1-ylhex-4-en-1-one;(2R)-2-formylpyrrolidine-1-carbonitrile |
| SMILES | C=N/C=C(\C=C/C)C(C(=O)N1CCCC1)N(C)c1ccc(C(C)(C)C)cc1.N#CN1CCC[C@@H]1C=O |
| InChI | InChI=1S/C23H33N3O.C6H8N2O/c1-7-10-18(17-24-5)21(22(27)26-15-8-9-16-26)25(6)20-13-11-19(12-14-20)23(2,3)4;7-5-8-3-1-2-6(8)4-9/h7,10-14,17,21H,5,8-9,15-16H2,1-4,6H3;4,6H,1-3H2/b10-7-,18-17+;/t;6-/m.1/s1 |
| InChIKey | NPQHSJQASZRQSJ-IIMZMOPTSA-N |
| XLogP | 4.70 |
| TPSA | 80.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|