C29H42N6O3 — CID 156893089
N-(4-tert-butylphenyl)-1-cyano-N-[(Z,3E)-1-[3-(dimethylamino)propylamino]-3-[(methylideneamino)methylidene]-1-oxohex-4-en-2-yl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 156893089) has the molecular formula C29H42N6O3 and a molecular weight of 522.69 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1-cyano-N-[(Z,3E)-1-[3-(dimethylamino)propylamino]-3-[(methylideneamino)methylidene]-1-oxohex-4-en-2-yl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-1-cyano-N-[(Z,3E)-1-[3-(dimethylamino)propylamino]-3-[(methylideneamino)methylidene]-1-oxohex-4-en-2-yl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 156893089 |
| Molecular Formula | C29H42N6O3 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | N-(4-tert-butylphenyl)-1-cyano-N-[(Z,3E)-1-[3-(dimethylamino)propylamino]-3-[(methylideneamino)methylidene]-1-oxohex-4-en-2-yl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | C=N/C=C(\C=C/C)C(C(=O)NCCCN(C)C)N(C(=O)C1CC(O)CN1C#N)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H42N6O3/c1-8-10-21(18-31-5)26(27(37)32-15-9-16-33(6)7)35(23-13-11-22(12-14-23)29(2,3)4)28(38)25-17-24(36)19-34(25)20-30/h8,10-14,18,24-26,36H,5,9,15-17,19H2,1-4,6-7H3,(H,32,37)/b10-8-,21-18+ |
| InChIKey | PHBSXUXLMCPLND-DAJQFMFISA-N |
| XLogP | 2.83 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|