C13H13F2NO2 — CID 156896005
3-(difluoromethyl)-6,8-dimethylquinoline;formic acid (PubChem CID 156896005) has the molecular formula C13H13F2NO2 and a molecular weight of 253.25 g/mol. Its IUPAC name is 3-(difluoromethyl)-6,8-dimethylquinoline;formic acid.
| Compound Name | 3-(difluoromethyl)-6,8-dimethylquinoline;formic acid |
|---|---|
| PubChem CID | 156896005 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-(difluoromethyl)-6,8-dimethylquinoline;formic acid |
| SMILES | Cc1cc(C)c2ncc(C(F)F)cc2c1.O=CO |
| InChI | InChI=1S/C12H11F2N.CH2O2/c1-7-3-8(2)11-9(4-7)5-10(6-15-11)12(13)14;2-1-3/h3-6,12H,1-2H3;1H,(H,2,3) |
| InChIKey | QUIAQYKGWCEBKB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|