C13H26O7S — CID 15690335
(2S,3S,4S,5R,6S)-2-(hexylsulfonylmethyl)-6-methoxyoxane-3,4,5-triol (PubChem CID 15690335) has the molecular formula C13H26O7S and a molecular weight of 326.41 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-2-(hexylsulfonylmethyl)-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2S,3S,4S,5R,6S)-2-(hexylsulfonylmethyl)-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 15690335 |
| Molecular Formula | C13H26O7S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (2S,3S,4S,5R,6S)-2-(hexylsulfonylmethyl)-6-methoxyoxane-3,4,5-triol |
| SMILES | CCCCCCS(=O)(=O)C[C@H]1O[C@H](OC)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H26O7S/c1-3-4-5-6-7-21(17,18)8-9-10(14)11(15)12(16)13(19-2)20-9/h9-16H,3-8H2,1-2H3/t9-,10-,11+,12-,13+/m1/s1 |
| InChIKey | DCWVJLDFARCTDI-LBELIVKGSA-N |
| XLogP | -0.56 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|