C15H30O7S — CID 15690336
(2S,3R,4S,5S,6S)-2-methoxy-6-(octylsulfonylmethyl)oxane-3,4,5-triol (PubChem CID 15690336) has the molecular formula C15H30O7S and a molecular weight of 354.47 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-2-methoxy-6-(octylsulfonylmethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6S)-2-methoxy-6-(octylsulfonylmethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 15690336 |
| Molecular Formula | C15H30O7S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (2S,3R,4S,5S,6S)-2-methoxy-6-(octylsulfonylmethyl)oxane-3,4,5-triol |
| SMILES | CCCCCCCCS(=O)(=O)C[C@H]1O[C@H](OC)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H30O7S/c1-3-4-5-6-7-8-9-23(19,20)10-11-12(16)13(17)14(18)15(21-2)22-11/h11-18H,3-10H2,1-2H3/t11-,12-,13+,14-,15+/m1/s1 |
| InChIKey | GENXUHXPZGCBBO-QMIVOQANSA-N |
| XLogP | 0.22 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|