C26H13BrF6N2O2 — CID 156903899
2-[3-amino-4-phenyl-2,6-bis(trifluoromethyl)phenyl]-6-bromobenzo[de]isoquinoline-1,3-dione (PubChem CID 156903899) has the molecular formula C26H13BrF6N2O2 and a molecular weight of 579.29 g/mol. Its IUPAC name is 2-[3-amino-4-phenyl-2,6-bis(trifluoromethyl)phenyl]-6-bromobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[3-amino-4-phenyl-2,6-bis(trifluoromethyl)phenyl]-6-bromobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 156903899 |
| Molecular Formula | C26H13BrF6N2O2 |
| Molecular Weight | 579.29 g/mol |
| Exact Mass | 578.01 |
| IUPAC Name | 2-[3-amino-4-phenyl-2,6-bis(trifluoromethyl)phenyl]-6-bromobenzo[de]isoquinoline-1,3-dione |
| SMILES | Nc1c(-c2ccccc2)cc(C(F)(F)F)c(N2C(=O)c3cccc4c(Br)ccc(c34)C2=O)c1C(F)(F)F |
| InChI | InChI=1S/C26H13BrF6N2O2/c27-18-10-9-15-19-13(18)7-4-8-14(19)23(36)35(24(15)37)22-17(25(28,29)30)11-16(12-5-2-1-3-6-12)21(34)20(22)26(31,32)33/h1-11H,34H2 |
| InChIKey | AGAVHTIWZVZTCD-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.29 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|