C13H24O5 — CID 15691044
ethyl 2-hydroxy-2-[6-(2-hydroxypropan-2-yl)-3-methyloxan-2-yl]acetate (PubChem CID 15691044) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-[6-(2-hydroxypropan-2-yl)-3-methyloxan-2-yl]acetate.
| Compound Name | ethyl 2-hydroxy-2-[6-(2-hydroxypropan-2-yl)-3-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 15691044 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | ethyl 2-hydroxy-2-[6-(2-hydroxypropan-2-yl)-3-methyloxan-2-yl]acetate |
| SMILES | CCOC(=O)C(O)C1OC(C(C)(C)O)CCC1C |
| InChI | InChI=1S/C13H24O5/c1-5-17-12(15)10(14)11-8(2)6-7-9(18-11)13(3,4)16/h8-11,14,16H,5-7H2,1-4H3 |
| InChIKey | WDZZWANTGFCMEH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |