C39H67O10P — CID 156966795
[(2R)-1-[(Z)-hexadec-9-enoyl]oxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate (PubChem CID 156966795) has the molecular formula C39H67O10P and a molecular weight of 726.93 g/mol. Its IUPAC name is [(2R)-1-[(Z)-hexadec-9-enoyl]oxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate.
| Compound Name | [(2R)-1-[(Z)-hexadec-9-enoyl]oxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate |
|---|---|
| PubChem CID | 156966795 |
| Molecular Formula | C39H67O10P |
| Molecular Weight | 726.93 g/mol |
| Exact Mass | 726.45 |
| IUPAC Name | [(2R)-1-[(Z)-hexadec-9-enoyl]oxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C[C@@H](O)[C@H](O)CCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\CCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C39H67O10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-31-38(42)47-33-35(34-48-50(44,45)46)49-39(43)32-28-30-37(41)36(40)29-26-24-22-20-18-16-14-12-10-8-6-4-2/h6,8,12-15,18,20,24,26,35-37,40-41H,3-5,7,9-11,16-17,19,21-23,25,27-34H2,1-2H3,(H2,44,45,46)/b8-6-,14-12-,15-13-,20-18-,26-24-/t35-,36-,37-/m1/s1 |
| InChIKey | HMPXJDPWSDLBSI-MFQKFIBWSA-N |
| XLogP | 8.90 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.93 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|