C31H53O10P — CID 156970013
[(2R)-1-octanoyloxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate (PubChem CID 156970013) has the molecular formula C31H53O10P and a molecular weight of 616.73 g/mol. Its IUPAC name is [(2R)-1-octanoyloxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate.
| Compound Name | [(2R)-1-octanoyloxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate |
|---|---|
| PubChem CID | 156970013 |
| Molecular Formula | C31H53O10P |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.34 |
| IUPAC Name | [(2R)-1-octanoyloxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C[C@@H](O)[C@H](O)CCCC(=O)O[C@H](COC(=O)CCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C31H53O10P/c1-3-5-7-9-10-11-12-13-14-15-17-18-21-28(32)29(33)22-20-24-31(35)41-27(26-40-42(36,37)38)25-39-30(34)23-19-16-8-6-4-2/h5,7,10-11,13-14,17-18,27-29,32-33H,3-4,6,8-9,12,15-16,19-26H2,1-2H3,(H2,36,37,38)/b7-5-,11-10-,14-13-,18-17-/t27-,28-,29-/m1/s1 |
| InChIKey | SVRODAVAHXNZIF-RHJACEMASA-N |
| XLogP | 6.00 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|