C41H71O10P — CID 156967107
[(2R)-1-[(Z)-octadec-11-enoyl]oxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate (PubChem CID 156967107) has the molecular formula C41H71O10P and a molecular weight of 754.98 g/mol. Its IUPAC name is [(2R)-1-[(Z)-octadec-11-enoyl]oxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate.
| Compound Name | [(2R)-1-[(Z)-octadec-11-enoyl]oxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate |
|---|---|
| PubChem CID | 156967107 |
| Molecular Formula | C41H71O10P |
| Molecular Weight | 754.98 g/mol |
| Exact Mass | 754.48 |
| IUPAC Name | [(2R)-1-[(Z)-octadec-11-enoyl]oxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C[C@@H](O)[C@H](O)CCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C\CCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C41H71O10P/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-33-40(44)49-35-37(36-50-52(46,47)48)51-41(45)34-30-32-39(43)38(42)31-28-26-24-22-20-16-14-12-10-8-6-4-2/h6,8,12-15,20,22,26,28,37-39,42-43H,3-5,7,9-11,16-19,21,23-25,27,29-36H2,1-2H3,(H2,46,47,48)/b8-6-,14-12-,15-13-,22-20-,28-26-/t37-,38-,39-/m1/s1 |
| InChIKey | ZDIKNGQVBFKOFA-OZYLLARGSA-N |
| XLogP | 9.68 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.98 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|