C42H71O10P — CID 156967938
[(2R)-1-[(10Z,13Z)-nonadeca-10,13-dienoyl]oxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate (PubChem CID 156967938) has the molecular formula C42H71O10P and a molecular weight of 766.99 g/mol. Its IUPAC name is [(2R)-1-[(10Z,13Z)-nonadeca-10,13-dienoyl]oxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate.
| Compound Name | [(2R)-1-[(10Z,13Z)-nonadeca-10,13-dienoyl]oxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate |
|---|---|
| PubChem CID | 156967938 |
| Molecular Formula | C42H71O10P |
| Molecular Weight | 766.99 g/mol |
| Exact Mass | 766.48 |
| IUPAC Name | [(2R)-1-[(10Z,13Z)-nonadeca-10,13-dienoyl]oxy-3-phosphonooxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C[C@@H](O)[C@H](O)CCCC(=O)O[C@H](COC(=O)CCCCCCCC/C=C\C/C=C\CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C42H71O10P/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-34-41(45)50-36-38(37-51-53(47,48)49)52-42(46)35-31-33-40(44)39(43)32-29-27-25-23-21-16-14-12-10-8-6-4-2/h6,8,11-14,17-18,21,23,27,29,38-40,43-44H,3-5,7,9-10,15-16,19-20,22,24-26,28,30-37H2,1-2H3,(H2,47,48,49)/b8-6-,13-11-,14-12-,18-17-,23-21-,29-27-/t38-,39-,40-/m1/s1 |
| InChIKey | FXICFDGBEBLUJN-AMAIVQGFSA-N |
| XLogP | 9.84 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.99 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|