C41H67O10P — CID 156967699
[(2R)-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropyl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate (PubChem CID 156967699) has the molecular formula C41H67O10P and a molecular weight of 750.95 g/mol. Its IUPAC name is [(2R)-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropyl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate.
| Compound Name | [(2R)-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropyl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate |
|---|---|
| PubChem CID | 156967699 |
| Molecular Formula | C41H67O10P |
| Molecular Weight | 750.95 g/mol |
| Exact Mass | 750.45 |
| IUPAC Name | [(2R)-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropyl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)O[C@H](COC(=O)CCCC(O)C(O)C/C=C\C/C=C\C/C=C\CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C41H67O10P/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-33-41(45)51-37(36-50-52(46,47)48)35-49-40(44)34-30-32-39(43)38(42)31-28-26-24-22-20-16-14-12-10-8-6-4-2/h5,7,11-14,17-18,20-23,26,28,37-39,42-43H,3-4,6,8-10,15-16,19,24-25,27,29-36H2,1-2H3,(H2,46,47,48)/b7-5-,13-11-,14-12-,18-17-,22-20-,23-21-,28-26-/t37-,38?,39?/m1/s1 |
| InChIKey | ZDRAVWPPQFEHBO-NJNUNNEASA-N |
| XLogP | 9.23 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.95 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|